CAS 1604810-84-5
:THZ2
Description:
THZ2, with the CAS number 1604810-84-5, is a small molecule that has garnered attention in the field of medicinal chemistry, particularly for its role as a selective inhibitor of certain kinases. This compound is characterized by its ability to modulate biological pathways, making it a potential candidate for therapeutic applications, especially in cancer research. THZ2 is known for its specificity towards cyclin-dependent kinases (CDKs), which are crucial in regulating the cell cycle. The compound typically exhibits a moderate to high solubility in organic solvents, which is advantageous for various experimental applications. Its molecular structure includes specific functional groups that contribute to its biological activity and selectivity. Additionally, THZ2 has been studied for its effects on cellular processes, including proliferation and apoptosis, highlighting its potential as a tool for understanding kinase-related signaling pathways. Overall, THZ2 represents a significant advancement in the development of targeted therapies in oncology and other diseases linked to dysregulated kinase activity.
Formula:C31H28ClN7O2
InChI:InChI=1S/C31H28ClN7O2/c1-39(2)15-7-14-28(40)35-21-9-5-8-20(16-21)30(41)36-22-10-6-11-23(17-22)37-31-34-19-26(32)29(38-31)25-18-33-27-13-4-3-12-24(25)27/h3-14,16-19,33H,15H2,1-2H3,(H,35,40)(H,36,41)(H,34,37,38)/b14-7+
InChI key:InChIKey=FONRCZUZCHXWBD-VGOFMYFVSA-N
SMILES:ClC=1C(C=2C=3C(NC2)=CC=CC3)=NC(NC4=CC(NC(=O)C5=CC(NC(/C=C/CN(C)C)=O)=CC=C5)=CC=C4)=NC1
Synonyms:- N-[3-[[5-Chloro-4-(1H-indol-3-yl)-2-pyrimidinyl]amino]phenyl]-3-[[(2E)-4-(dimethylamino)-1-oxo-2-buten-1-yl]amino]benzamide
- THZ2
- Benzamide, N-[3-[[5-chloro-4-(1H-indol-3-yl)-2-pyrimidinyl]amino]phenyl]-3-[[(2E)-4-(dimethylamino)-1-oxo-2-buten-1-yl]amino]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
THZ2
CAS:THZ2 (CDK7-IN-1), an analog of THZ1, is a potent and selective CDK7 inhibitor(IC50:13.9 nM),with the potential to treat Triple-negative breast cancer (TNBC).Formula:C31H28ClN7O2Purity:98.28%Color and Shape:SolidMolecular weight:566.05THZ2
CAS:THZ2 is a pyrimidine compound that exhibits apoptotic cell death with an effective dose of 0.5-2.0 mg/kg in mice. THZ2 has been shown to be effective in tumor models, inducing apoptosis in cancer cells and reducing the size of tumors. It also induces apoptosis in inflammatory diseases and inhibits the progression of metabolic disorders such as diabetes mellitus. THZ2 causes c-jun-n-terminal kinase (JNK) activation, which is involved in the regulation of growth and proliferation. This drug has been shown to induce a frequency shift in DNA, which might be useful for diagnosis purposes, as well as radiation therapy. The hydroxyl group on this molecule can be used for conjugation to other drugs or molecules by esterification reactions or amide bond formation to increase its bioavailability and reduce toxicity.Formula:C31H28ClN7O2Purity:Min. 95%Molecular weight:566.05 g/mol



