CAS 160488-61-9
:Ethyl 6-bromo-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate
Description:
Ethyl 6-bromo-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring both a nitrogen atom and two ether functionalities. The presence of the bromine atom at the 6-position contributes to its reactivity and potential applications in organic synthesis. The ethyl ester group at the carboxylate position enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Additionally, the dioxa and azaspiro components suggest potential for diverse applications in medicinal chemistry and materials science. As with many synthetic compounds, safety and handling precautions should be observed, given the presence of halogenated and nitrogen-containing groups, which may pose specific hazards. Overall, this compound represents a fascinating example of complex organic chemistry with potential utility in research and development.
Formula:C10H16BrNO4
InChI:InChI=1S/C10H16BrNO4/c1-2-14-9(13)12-4-3-10(8(11)7-12)15-5-6-16-10/h8H,2-7H2,1H3
InChI key:InChIKey=QLCVEDMSYIVTPZ-UHFFFAOYSA-N
SMILES:BrC1C2(CCN(C(OCC)=O)C1)OCCO2
Synonyms:- 1,4-Dioxa-8-azaspiro[4.5]decane-8-carboxylic acid, 6-bromo-, ethyl ester
- Ethyl 6-bromo-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate
- Ethyl 3-bromo-4,4-ethylenedioxy-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Bromo-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylic Acid Ethyl Ester
CAS:Controlled ProductApplications 6-Bromo-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylic Acid Ethyl Ester is an intermediate in the synthesis of loratadine (L469575) related compounds.
References Bruttmann, G., et al.: J. Allergy Clin. Immunol., 83, 411 (1989), Haria, M., et al.: Drugs, 48, 617 (1994)Formula:C10H16BrNO4Color and Shape:NeatMolecular weight:294.14
