CAS 16052-40-7
:(1R,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexanecarboxylic acid
Description:
(1R,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexanecarboxylic acid, with CAS number 16052-40-7, is a chiral carboxylic acid characterized by its cyclohexane ring structure, which features a methyl group and an isopropyl group attached to specific carbon atoms. This compound exhibits stereoisomerism due to the presence of multiple chiral centers, influencing its physical and chemical properties. Typically, carboxylic acids like this one are known for their acidic nature, which allows them to donate protons in solution, and they can participate in various chemical reactions, including esterification and amidation. The presence of bulky substituents can affect the compound's solubility, boiling point, and reactivity. Additionally, the specific stereochemistry may impact its biological activity and interactions with other molecules, making it of interest in fields such as pharmaceuticals and organic synthesis. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with multiple functional groups and stereocenters.
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c1-7(2)9-5-4-8(3)6-10(9)11(12)13/h7-10H,4-6H2,1-3H3,(H,12,13)/t8-,9+,10-/m1/s1
InChI key:InChIKey=MNVSUVYRIVXDBK-KXUCPTDWSA-N
SMILES:[C@H](C)(C)[C@H]1[C@H](C(O)=O)C[C@H](C)CC1
Synonyms:- (-)-Menthylformic acid
- (1R,2S,5R)-2-isopropyl-5-methylcyclohexanecarboxylic acid
- (1R,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexanecarboxylic acid
- (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanecarboxylic acid
- (1R,3R,4S)-p-Menthane-3-carboxylic acid
- (1R-(1alpha,2beta,5alpha))-2-(Isopropyl)-5-methylcyclohexanecarboxylic acid
- 5-Methyl-2-(Propan-2-Yl)Cyclohexanecarboxylic Acid
- Cyclohexanecarboxylic acid, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-
- Cyclohexanecarboxylic acid, 5-methyl-2-(1-methylethyl)-, [1R-(1α,2β,5α)]-
- p-Menthane-3-carboxylic acid, (1R,3R,4S)-(-)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyclohexanecarboxylic acid, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-
CAS:Formula:C11H20O2Purity:97%Color and Shape:SolidMolecular weight:184.2753Ref: IN-DA001RZK
250mg25.00€1g28.00€100mg28.00€5g65.00€10g122.00€15g140.00€25g213.00€50g291.00€100g525.00€75g576.00€(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic acid
CAS:(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic acidPurity:98%Molecular weight:184.28g/mol(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic Acid
CAS:Formula:C11H20O2Color and Shape:NeatMolecular weight:184.27(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic acid
CAS:Formula:C11H20O2Purity:95%Color and Shape:SolidMolecular weight:184.279(1R,2S,5R)-2-Isopropyl-5-methyl-cyclohexanecarboxylic acid
CAS:(1R,2S,5R)-2-Isopropyl-5-methyl-cyclohexanecarboxylic acid is a liquid that is used in the synthesis of ethyl alcohol. It is produced by the condensation of benzene and acetone and reacts with sulfuric acid to form a mixture of dimethylbenzene, methanol, and water. This compound also serves as an intermediate for the production of perfumes, catalysts for other chemical reactions, and industrial solvents. It is used in the manufacture of tobacco products such as cigarettes and cigars.Formula:C11H20O2Purity:Min. 95%Molecular weight:184.28 g/mol





