CAS 160538-51-2

3-Fluoro-4-Nitro-Benzaldehyde

Description:

3-Fluoro-4-nitro-benzaldehyde is an aromatic compound characterized by the presence of both a fluorine atom and a nitro group attached to a benzaldehyde structure. The fluorine atom is located at the meta position relative to the aldehyde group, while the nitro group is positioned at the para position. This compound typically exhibits a pale yellow to light brown appearance and is known for its reactivity due to the presence of both electron-withdrawing groups (the nitro and fluoro substituents) and the aldehyde functional group. It is soluble in organic solvents and may have limited solubility in water. The presence of the nitro group can influence the compound's electronic properties, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 3-fluoro-4-nitro-benzaldehyde can participate in various chemical reactions, including nucleophilic substitutions and reductions, making it a valuable compound in synthetic organic chemistry. Safety precautions should be taken when handling this substance due to its potential toxicity and reactivity.

Formula: C₇H₄FNO₃

InChI: InChI=1/C7H4FNO3/c8-6-3-5(4-10)1-2-7(6)9(11)12/h1-4H

SMILES: c1cc(c(cc1C=O)F)N(=O)=O

Synonyms:

• 3-Fluoro-4-Nitrobenzenecarbaldehyde
• 3-Fluoro-4-Nitrobenzaldehyde

3-Fluoro-4-nitrobenzaldehyde

CAS: 160538-51-2

Formula: C₇H₄FNO₃

Purity: >97.0%(GC)

Color and Shape: Light yellow to Amber powder to crystal

Molecular weight: 169.11

Ref: 3B-F1130

Benzaldehyde, 3-fluoro-4-nitro-

CAS: 160538-51-2

Formula: C₇H₄FNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 169.1100

Ref: IN-DA001RZS

3-Fluoro-4-nitrobenzaldehyde

CAS: 160538-51-2

3-Fluoro-4-nitrobenzaldehyde

Formula: C₇H₄FNO₃

Purity: 95%

Color and Shape: yellow/brown crystals

Molecular weight: 169.11g/mol

Ref: 54-PC7624

3-Fluoro-4-nitrobenzaldehyde

CAS: 160538-51-2

Formula: C₇H₄FNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.111

Ref: 10-F236908