CAS 160538-52-3
:3-Fluoro-4-nitrobenzenemethanamine
Description:
3-Fluoro-4-nitrobenzenemethanamine, with the CAS number 160538-52-3, is an organic compound characterized by the presence of a fluorine atom and a nitro group attached to a benzene ring, along with an amine functional group. This compound features a benzene ring substituted at the 3-position with a fluorine atom and at the 4-position with a nitro group, while the methanamine group is attached to the benzene at the 1-position. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and polarity. The fluorine atom can affect the compound's lipophilicity and overall stability. As an amine, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on its reactivity and the context of its use. Safety data and handling precautions should be consulted due to the potential hazards associated with its chemical structure.
Formula:C7H7FN2O2
InChI:InChI=1S/C7H7FN2O2/c8-6-3-5(4-9)1-2-7(6)10(11)12/h1-3H,4,9H2
InChI key:InChIKey=JTOJWHIKGYSSGT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(F)C=C(CN)C=C1
Synonyms:- Benzenemethanamine, 3-fluoro-4-nitro-
- 3-Fluoro-4-nitrobenzenemethanamine
- (3-Fluoro-4-nitrophenyl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
