CAS 160542-03-0

1-Ethoxy-4-ethynyl-2-fluorobenzene

Description:

1-Ethoxy-4-ethynyl-2-fluorobenzene, with the CAS number 160542-03-0, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and an ethoxy group attached to a benzene ring. The presence of the ethynyl group introduces a triple bond, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit moderate polarity due to the ethoxy and fluorine substituents, influencing its solubility in various solvents. Additionally, the fluorine atom can enhance the compound's stability and alter its electronic properties, making it of interest in materials science and medicinal chemistry. Its synthesis typically involves reactions that form carbon-carbon bonds, which are crucial in constructing complex organic molecules. As with many fluorinated compounds, it may exhibit unique biological activities, warranting further investigation into its potential uses in pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₉FO

InChI: InChI=1S/C10H9FO/c1-3-8-5-6-10(12-4-2)9(11)7-8/h1,5-7H,4H2,2H3

InChI key: InChIKey=MRORUJPBOBHBLB-UHFFFAOYSA-N

SMILES: O(CC)C1=C(F)C=C(C#C)C=C1

Synonyms:

• 1-Ethoxy-4-ethynyl-2-fluorobenzene
• Benzene, 1-ethoxy-4-ethynyl-2-fluoro-
• 1-(3′-Fluoro-4′-ethoxyphenyl)acetylene

1-Ethoxy-4-ethynyl-2-fluorobenzene

CAS: 160542-03-0

Versatile small molecule scaffold

Formula: C₁₀H₉FO

Purity: Min. 95%

Molecular weight: 164.18 g/mol

Ref: 3D-KGA54203