CAS 160549-09-7
:(3S,4R,6R)-3-Hexyltetrahydro-4-hydroxy-6-undecyl-2H-pyran-2-one
Description:
The chemical substance known as (3S,4R,6R)-3-Hexyltetrahydro-4-hydroxy-6-undecyl-2H-pyran-2-one, with the CAS number 160549-09-7, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a pyranone ring, which is a six-membered cyclic structure containing both oxygen and a carbonyl group, contributing to its reactivity and potential biological activity. The presence of hydroxy and heptyl substituents indicates that it may exhibit hydrophilic and lipophilic properties, which can influence its solubility and interaction with biological membranes. The stereochemical configuration (3S,4R,6R) suggests that the compound has specific spatial arrangements that may be crucial for its biological function or activity. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential therapeutic applications. Additionally, the presence of long hydrocarbon chains may suggest that it could have surfactant properties or play a role in membrane dynamics. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and biological contexts.
Formula:C22H42O3
InChI:InChI=1/C22H42O3/c1-3-5-7-9-10-11-12-13-14-16-19-18-21(23)20(22(24)25-19)17-15-8-6-4-2/h19-21,23H,3-18H2,1-2H3/t19-,20+,21-/m1/s1
InChI key:InChIKey=LRXRIVSWHMVULO-QHAWAJNXSA-N
SMILES:C(CCCCCCCCCC)[C@@H]1C[C@@H](O)[C@H](CCCCCC)C(=O)O1
Synonyms:- 2H-Pyran-2-one, 3-hexyltetrahydro-4-hydroxy-6-undecyl-, [3S-(3α,4β,6α)]-
- 2H-Pyran-2-one, 3-hexyltetrahydro-4-hydroxy-6-undecyl-, (3S,4R,6R)-
- (3S,4R,6R)-3-Hexyltetrahydro-4-hydroxy-6-undecyl-2H-pyran-2-one
- Orlistat Impurity 44
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
