CAS 160590-36-3

2-Methoxy-3-Nitro-4-Picoline

Description:

2-Methoxy-3-Nitro-4-Picoline, with the CAS number 160590-36-3, is an organic compound that belongs to the class of nitro-substituted pyridines. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with a methoxy group (-OCH3) and a nitro group (-NO2) at specific positions. This compound is typically characterized by its yellow to brownish color and may exhibit a distinct odor. It is soluble in organic solvents, but its solubility in water is limited. The presence of the nitro group contributes to its potential reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. As with many nitro compounds, it may pose certain hazards, including toxicity and environmental concerns, necessitating careful handling and disposal. Overall, 2-Methoxy-3-Nitro-4-Picoline is a valuable compound in organic chemistry with specific applications in research and industry.

Formula: C₇H₈N₂O₃

InChI: InChI=1/C7H8N2O3/c1-5-3-4-8-7(12-2)6(5)9(10)11/h3-4H,1-2H3

SMILES: Cc1ccnc(c1N(=O)=O)OC

Synonyms:

• 2-Methoxy-4-Methyl-3-Nitropyridine

Pyridine, 2-methoxy-4-methyl-3-nitro-

CAS: 160590-36-3

Formula: C₇H₈N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.1500

Ref: IN-DA001S26

2-Methoxy-4-methyl-3-nitropyridine

CAS: 160590-36-3

2-Methoxy-4-methyl-3-nitropyridine

Purity: 99%

Molecular weight: 168.15002g/mol

Ref: 54-OR2916

2-Methoxy-4-methyl-3-nitropyridine

CAS: 160590-36-3

Formula: C₇H₈N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.152

Ref: 10-F036176