CAS 16063-79-9
:4,4,4-trifluoro-dl-valine
Description:
4,4,4-Trifluoro-dl-valine is a fluorinated amino acid derivative of valine, characterized by the presence of three fluorine atoms attached to the alpha carbon of the valine structure. This modification significantly alters its chemical properties, including increased hydrophobicity and potential changes in biological activity. The presence of fluorine can enhance the stability of the molecule and influence its interactions with biological systems, making it of interest in pharmaceutical research and development. The compound is typically a white crystalline solid at room temperature and is soluble in polar solvents. Its unique structure allows it to serve as a building block in the synthesis of various peptides and proteins, particularly in studies involving fluorinated compounds. Additionally, 4,4,4-trifluoro-dl-valine may exhibit distinct metabolic pathways compared to its non-fluorinated counterparts, which can be crucial for understanding its role in biochemical processes. Safety data should be consulted for handling, as fluorinated compounds can have specific toxicity profiles.
Formula:C5H8F3NO2
InChI:InChI=1/C5H8F3NO2/c1-2(5(6,7)8)3(9)4(10)11/h2-3H,9H2,1H3,(H,10,11)
SMILES:CC(C(C(=O)O)N)C(F)(F)F
Synonyms:- 4,4,4-Trifluorovaline
- 4,4,4-trifluoro-L-valine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,4,4-Trifluoro-DL-valine
CAS:Formula:C5H8F3NO2Purity:97%Color and Shape:SolidMolecular weight:171.11774,4,4-Trifluoro-DL-valine
CAS:4,4,4-Trifluoro-DL-valineFormula:C5H8F3NO2Purity:97%Color and Shape: solidMolecular weight:171.12g/mol4,4,4-Trifluorovaline
CAS:<p>4,4,4-Trifluorovaline is a chemical compound with a trifluoromethyl group that can be synthesized in an efficient method. It has been shown to have the ability to stabilize proteins and enzymes in recombinant systems. The enolate of 4,4,4-trifluorovaline reacts with amides to form allylations. The stereoselective synthesis of 4,4,4-trifluorovaline isomers produces two diastereoisomers that are separated by either chiral chromatography or crystallization. These methods allow for the introduction of 4,4,4-trifluorovaline into cellular systems without affecting the stability of the protein or enzyme.</p>Formula:C5H8F3NO2Purity:Min. 95%Molecular weight:171.12 g/mol


