CAS 16063-85-7
:biphenyl-4-yl hydrogenato(2-) sulfate
Description:
Biphenyl-4-yl hydrogenato(2-) sulfate, also known by its CAS number 16063-85-7, is an organic compound characterized by the presence of a biphenyl structure substituted with a sulfate group. This compound typically exhibits properties associated with both aromatic compounds and sulfonic acids, including stability under various conditions and potential solubility in polar solvents. The biphenyl moiety contributes to its hydrophobic characteristics, while the sulfate group enhances its polarity and reactivity, particularly in acid-base reactions. This compound may be utilized in various chemical applications, including as an intermediate in organic synthesis or in the production of surfactants. Its reactivity can be influenced by the presence of the sulfate group, which can participate in nucleophilic substitution reactions. Safety data sheets should be consulted for handling and storage guidelines, as compounds with sulfate groups can sometimes be corrosive or irritative. Overall, biphenyl-4-yl hydrogenato(2-) sulfate represents a unique intersection of aromatic chemistry and sulfonate functionality.
Formula:C12H10O4S
InChI:InChI=1/C12H10O4S/c13-17(14,15)16-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,13,14,15)
SMILES:c1ccc(cc1)c1ccc(cc1)OS(=O)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Hydroxy Biphenyl Sulfate Sodium Salt
CAS:Formula:C12H9O4S·NaColor and Shape:White To Off-White SolidMolecular weight:249.27 22.994-Hydroxy Biphenyl-d5 Sulfate Sodium Salt
CAS:Formula:C12H4O4SD5·NaColor and Shape:White To Off-White SolidMolecular weight:254.30 22.99
