CAS 160632-05-3

N-(7-Oxadecyl)deoxynojirimycin

Description:

N-(7-Oxadecyl)deoxynojirimycin is a synthetic derivative of deoxynojirimycin, which is a naturally occurring alkaloid known for its role as an inhibitor of glycosidases. This compound features a long alkyl chain, specifically a heptadecyl group, which enhances its lipophilicity and may influence its biological activity and membrane permeability. The presence of the oxadecyl group suggests potential applications in medicinal chemistry, particularly in the development of antiviral or antidiabetic agents, as deoxynojirimycin itself has been studied for its ability to inhibit certain enzymes involved in carbohydrate metabolism. The compound's structure allows it to interact with various biological targets, potentially modulating glycosylation processes. Additionally, its solubility characteristics may vary based on the length of the alkyl chain, impacting its formulation and delivery in pharmaceutical applications. Overall, N-(7-Oxadecyl)deoxynojirimycin represents a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential therapeutic applications.

Formula: C₁₅H₃₁NO₅

InChI: InChI=1/C15H31NO5/c1-2-8-21-9-6-4-3-5-7-16-10-13(18)15(20)14(19)12(16)11-17/h12-15,17-20H,2-11H2,1H3

SMILES: CCCOCCCCCCN1CC(C(C(C1CO)O)O)O

Synonyms:

• 2-(Hydroxymethyl)-1-(6-Propoxyhexyl)Piperidine-3,4,5-Triol

N-(7-Oxadecyl)deoxynojirimycin

CAS: 160632-05-3

Ref: 7W-GC0384

N-(7-Oxadecyl)deoxynojirimycin

CAS: 160632-05-3

N-(7-Oxadecyl)deoxynojirimycin is a chaperone protein. It belongs to the group of proteins that are deficient in patients with type 1 glycogen storage disease and can be used to treat this condition. N-(7-Oxadecyl)deoxynojirimycin has been shown to bind to the endoplasmic reticulum, thereby preventing the maturation of certain proteins and their transport into other cellular compartments. This agent also has a protective function in muscle cells by preventing protein degradation due to abnormal folding or misfolding. The long-term effect of N-(7-Oxadecyl)deoxynojirimycin on skeletal muscle is unclear, although it has been found to be beneficial in the short term for patients with type 1 glycogen storage disease.

Formula: C₁₅H₃₁NO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 305.41 g/mol

Ref: 3D-MO04818