CAS 16065-26-2

N-Propyl-3-(trifluoromethyl)benzenemethanamine

Description:

N-Propyl-3-(trifluoromethyl)benzenemethanamine, with the CAS number 16065-26-2, is an organic compound characterized by its structure, which includes a propyl group and a trifluoromethyl group attached to a benzene ring. This compound is classified as an aromatic amine due to the presence of the amine functional group (-NH2) linked to a benzyl carbon. The trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential for enhanced biological activity. The presence of fluorine atoms can also influence the compound's reactivity and stability, making it of interest in various chemical and pharmaceutical applications. Typically, compounds like this may exhibit moderate to high boiling points and solubility in organic solvents, while their reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group. Safety data should be consulted for handling and potential toxicity, as aromatic amines can pose health risks. Overall, N-Propyl-3-(trifluoromethyl)benzenemethanamine is a compound of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₁H₁₄F₃N

InChI: InChI=1S/C11H14F3N/c1-2-6-15-8-9-4-3-5-10(7-9)11(12,13)14/h3-5,7,15H,2,6,8H2,1H3

InChI key: InChIKey=CPXTUPBVFMKPOF-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(CNCCC)=CC=C1

Synonyms:

• Benzenemethanamine, N-propyl-3-(trifluoromethyl)-
• Benzylamine, N-propyl-m-(trifluoromethyl)-
• N-Propyl-3-(trifluoromethyl)benzenemethanamine

propyl({[3-(trifluoromethyl)phenyl]methyl})amine

CAS: 16065-26-2

Formula: C₁₁H₁₄F₃N

Purity: 95.0%

Molecular weight: 217.235

Ref: 10-F523089