CAS 16066-09-4: 1,1,1,3,5,7,7,7-Octamethyltetrasiloxane
Description:1,1,1,3,5,7,7,7-Octamethyltetrasiloxane, with CAS number 16066-09-4, is a siloxane compound characterized by its unique structure comprising a siloxane backbone with multiple methyl groups attached. This compound is part of a larger class of organosilicon compounds known for their versatility and stability. It typically exhibits low viscosity and high thermal stability, making it suitable for various applications, including as a lubricant, surfactant, or in cosmetic formulations. The presence of multiple methyl groups contributes to its hydrophobic properties, enhancing its effectiveness in repelling water and providing a barrier against moisture. Additionally, its chemical stability allows it to resist degradation under a range of environmental conditions. Due to these characteristics, 1,1,1,3,5,7,7,7-Octamethyltetrasiloxane is often utilized in industrial applications, personal care products, and as a component in silicone-based formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H26O3Si4
InChI:InChI=1S/C8H26O3Si4/c1-12(10-14(3,4)5)9-13(2)11-15(6,7)8/h12-13H,1-8H3
InChI key:InChIKey=LBPUHXCOWXUVCE-UHFFFAOYSA-N
SMILES:O([SiH](O[Si](C)(C)C)C)[SiH](O[Si](C)(C)C)C
- Synonyms:
- 1,1,1,3,5,7,7,7-Octamethyltetrasiloxane
- 1,3-Bis(Trimethylsiloxy)
- 3H,5H-Octamethyltetrasiloxane
- H Oil
- Ls 8630
- Sib 1838.0
- Tetrasiloxane, 1,1,1,3,5,7,7,7-octamethyl-
- 1,3-Bis(trimethylsiloxy)-1,3-dimethyldisiloxane
