CymitQuimica logo

CAS 160664-95-9

:

5-HYDRAZINO-2-METHOXYPYRIDINE

Description:
5-Hydrazino-2-methoxypyridine is an organic compound characterized by the presence of a pyridine ring substituted with a hydrazino group and a methoxy group. The molecular structure features a five-membered aromatic ring, which contributes to its potential reactivity and biological activity. The hydrazino group (-NH-NH2) is known for its ability to form hydrazones and can participate in various chemical reactions, including condensation and oxidation. The methoxy group (-OCH3) enhances the compound's solubility in organic solvents and may influence its electronic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyridine and hydrazine are often explored for their pharmacological properties. Additionally, the presence of both hydrazine and methoxy functionalities may impart unique characteristics, such as increased reactivity or specific interactions with biological targets. Overall, 5-hydrazino-2-methoxypyridine is a versatile compound with potential implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C6H9N3O
InChI:InChI=1/C6H9N3O/c1-10-6-3-2-5(9-7)4-8-6/h2-4,9H,7H2,1H3
InChI key:SRQWKLIXHJRVSG-UHFFFAOYSA-N
SMILES:COc1ccc(cn1)NN
Synonyms:
  • Pyridine,5-hydrazino-2-methoxy
  • Pyridine, 5-hydrazino-2-methoxy- (9CI)
  • Pyridine,5-hydrazinyl-2-methoxy-
  • 5-Hydrazinyl-2-Methoxypyridine
Found 2 products.