
CAS 160716-45-0
:3-(Trimethoxysilyl)propyl acrylate homopolymer
Description:
3-(Trimethoxysilyl)propyl acrylate homopolymer is a silane-modified polymer that exhibits unique characteristics due to its chemical structure. This polymer is derived from the polymerization of 3-(trimethoxysilyl)propyl acrylate, which contains both acrylate and silane functional groups. The presence of the trimethoxysilyl group enhances adhesion properties, making it suitable for applications in coatings, adhesives, and sealants, particularly in environments requiring moisture resistance and durability. The acrylate component contributes to the polymer's flexibility and mechanical strength. Additionally, this homopolymer can form cross-linked networks when cured, further improving its thermal stability and chemical resistance. It is often utilized in formulations that require enhanced bonding to substrates such as glass, metal, and ceramics. The polymer's compatibility with various fillers and additives allows for customization of its properties, making it versatile for industrial applications. Overall, 3-(trimethoxysilyl)propyl acrylate homopolymer is valued for its multifunctional characteristics, combining the benefits of silane chemistry with the performance of acrylate polymers.
Formula:(C9H18O5Si)x
InChI:InChI=1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3
InChI key:InChIKey=KBQVDAIIQCXKPI-UHFFFAOYSA-N
SMILES:[Si](CCCOC(C=C)=O)(OC)(OC)OC
Synonyms:- (γ-Acryloxypropyl)trimethoxysilane homopolymer
- 2-Propenoic acid, 3-(trimethoxysilyl)propyl ester, homopolymer
- [3-(Acryloyloxy)propyl]trimethoxysilane homopolymer
- 3-(Trimethoxysilyl)propyl acrylate homopolymer
- Poly(3-(trimethoxysilyl)propyl acrylate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
