CAS 160727-03-7
:bromo-(2,4,5-trimethylphenyl)magnesium
Description:
Bromo-(2,4,5-trimethylphenyl)magnesium, with the CAS number 160727-03-7, is an organomagnesium compound belonging to the class of Grignard reagents. These reagents are characterized by their highly reactive nature, particularly towards electrophiles, making them valuable in organic synthesis. The presence of the bromo group indicates that it can participate in nucleophilic substitution reactions, while the trimethylphenyl group contributes to the compound's steric and electronic properties. Typically, Grignard reagents are used to form carbon-carbon bonds, enabling the synthesis of alcohols, ketones, and other functional groups. This specific compound is likely to be sensitive to moisture and air, requiring an anhydrous environment for handling and storage. Its reactivity can also lead to the formation of various by-products if not managed properly. Overall, bromo-(2,4,5-trimethylphenyl)magnesium serves as a useful intermediate in synthetic organic chemistry, particularly in the construction of complex molecular architectures.
Formula:C9H11BrMg
InChI:InChI=1/C9H11.BrH.Mg/c1-7-4-5-8(2)9(3)6-7;;/h5-6H,1-3H3;1H;/q;;+1/p-1/rC9H11BrMg/c1-6-4-8(3)9(11-10)5-7(6)2/h4-5H,1-3H3
SMILES:CC1=C=CC(C)C(=C1)C.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
