CAS 16078-37-8

5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinolin-2(1H)-one

Description:

5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinolin-2(1H)-one, with the CAS number 16078-37-8, is a heterocyclic organic compound characterized by its fused pyrrole and quinoline structures. This compound typically exhibits a bicyclic framework, which contributes to its unique chemical properties. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. The presence of nitrogen atoms in its structure can influence its reactivity and solubility, often leading to interactions with biological targets. Additionally, the compound may exhibit fluorescence, which can be useful in various analytical applications. Its synthesis often involves multi-step organic reactions, and it may serve as a building block for more complex molecules in drug development. Overall, 5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinolin-2(1H)-one is a compound of significant interest due to its structural complexity and potential pharmacological applications.

Formula: C₁₁H₁₁NO

InChI: InChI=1S/C11H11NO/c13-10-7-9-4-1-3-8-5-2-6-12(10)11(8)9/h1,3-4H,2,5-7H2

InChI key: InChIKey=HJJITGDIXLDFIX-UHFFFAOYSA-N

SMILES: O=C1N2C=3C(C1)=CC=CC3CCC2

Synonyms:

• 4H-Pyrrolo[3,2,1-ij]quinolin-2(1H)-one, 5,6-dihydro-
• 2-Lilolidone
• 5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinolin-2(1H)-one

1-Azatricyclo[6.3.1.0,4,12]dodeca-4,6,8(12)-trien-2-one

CAS: 16078-37-8

Azatricyclo[6.3.1.0,4,12]dodeca-4,6,8(12)-trien-2-one (ATC) is a synthetic compound that has been shown to have anti-inflammatory and antipsychotic effects. It also has been shown to be an effective antidepressant drug in the treatment of chronic kidney disease. ATC binds to the nitric oxide synthase protein to inhibit its catalytic activity and reduce nitric oxide production, which is associated with inflammation and pain. In addition, ATC has been found to decrease glutamate release by inhibiting glutamate receptors in the brain and induce apoptosis in cancer cells.
ATC is a heterocycle with a bicyclic structure consisting of two six-membered rings fused together with an eight-membered ring attached at one end.

Formula: C₁₁H₁₁NO

Purity: Min. 95%

Molecular weight: 173.21 g/mol

Ref: 3D-RAA07837