CymitQuimica logo

CAS 160788-56-7

:

Piperidinium, 1-methyl-1-(3-sulfopropyl)-, inner salt

Description:
Piperidinium, 1-methyl-1-(3-sulfopropyl)-, inner salt, with CAS number 160788-56-7, is a quaternary ammonium compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a methyl group and a sulfonic acid-derived propyl chain, contributing to its solubility in water and potential applications in various chemical processes. As an inner salt, it possesses both cationic and anionic characteristics, which can enhance its stability and reactivity in different environments. The presence of the sulfonate group typically imparts good solubility in polar solvents and may influence its biological activity, making it of interest in pharmaceutical and biochemical research. Additionally, the compound's structure suggests potential uses in surfactants, ion exchange materials, or as a phase transfer catalyst. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the conditions under which it is studied, including temperature and pH.
Formula:C9H19NO3S
InChI:InChI=1S/C9H19NO3S/c1-10(6-3-2-4-7-10)8-5-9-14(11,12)13/h2-9H2,1H3
InChI key:InChIKey=DQNQWAVIDNVATL-UHFFFAOYSA-N
SMILES:C(CCS(=O)(=O)[O-])[N+]1(C)CCCCC1
Synonyms:
  • NDSB 221
  • 3-(1-Methylpiperidinio)-1-propanesulfonate
  • Piperidinium, 1-methyl-1-(3-sulfopropyl)-, inner salt
Found 3 products.