CAS 160791-64-0
:[3-(4-bromophenoxy)phenyl](cyano)methyl 2-[4-(difluoromethoxy)phenyl]-3-methylbutanoate
Description:
The chemical substance known as "[3-(4-bromophenoxy)phenyl](cyano)methyl 2-[4-(difluoromethoxy)phenyl]-3-methylbutanoate," with the CAS number 160791-64-0, is a complex organic compound characterized by its multi-functional groups. It features a cyano group, which is known for its reactivity and ability to participate in various chemical reactions, as well as ester functionality due to the butanoate moiety. The presence of bromine and difluoromethoxy substituents suggests potential for significant biological activity, as halogenated compounds often exhibit unique pharmacological properties. The compound's structure indicates it may possess lipophilic characteristics, which can influence its solubility and permeability in biological systems. Additionally, the presence of multiple aromatic rings may contribute to its stability and interaction with biological targets. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C26H22BrF2NO4
InChI:InChI=1/C26H22BrF2NO4/c1-16(2)24(17-6-10-21(11-7-17)33-26(28)29)25(31)34-23(15-30)18-4-3-5-22(14-18)32-20-12-8-19(27)9-13-20/h3-14,16,23-24,26H,1-2H3
Synonyms:- 160791-64-0
- Benzeneacetic acid,4-(difluoromethoxy)-a-(1-methylethyl)-, [3-(4-bromophenoxy)phenyl]cyanomethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Brofluthrinate (>90%)
CAS:Controlled ProductFormula:C26H22BrF2NO4Color and Shape:NeatMolecular weight:530.358Brofluthrinate
CAS:Brofluthrinate is a kinase inhibitor that has shown potential as an anti-cancer agent. It has been found to inhibit the growth of human tumor and leukemia cells, including acute myeloid leukemia. Brofluthrinate works by inhibiting the activity of various kinases involved in cell proliferation, angiogenesis, and apoptosis. It also has antibacterial activity against certain strains of bacteria. In endothelial cells, brofluthrinate blocks phosphorylation and activation of proteins involved in angiogenesis, which may contribute to its anti-cancer effects. Overall, brofluthrinate is a promising compound for further investigation as a potential cancer treatment.
Formula:C26H22BrF2NO4Purity:Min. 95%Molecular weight:530.4 g/mol



