CymitQuimica logo

CAS 160800-65-7

:

1-Pyrrolidinecarboxylic acid,2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-, 1,1-dimethylethyl ester, (2S)-

Description:
1-Pyrrolidinecarboxylic acid, 2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-, 1,1-dimethylethyl ester, (2S)-, is a complex organic compound characterized by its intricate molecular structure, which includes a pyrrolidine ring and various functional groups such as carboxylic acid and ester moieties. This compound is known for its potential biological activity, particularly in pharmaceutical applications, where it may serve as a precursor or intermediate in the synthesis of bioactive molecules. The presence of multiple chiral centers indicates that it may exhibit stereoisomerism, which can significantly influence its biological properties and interactions. Additionally, the compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Its CAS number, 160800-65-7, allows for precise identification and reference in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound exemplifies the complexity and diversity of organic molecules used in drug discovery and development.
Formula:C23H36N2O5
InChI:InChI=1S/C23H36N2O5/c1-15(21(27)24-16(2)19(26)17-11-8-7-9-12-17)20(29-6)18-13-10-14-25(18)22(28)30-23(3,4)5/h7-9,11-12,15-16,18-20,26H,10,13-14H2,1-6H3,(H,24,27)/t15-,16-,18+,19-,20-/m1/s1
InChI key:XJDVGABQIFOWFC-SCQOQHIRSA-N
SMILES:C[C@H]([C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)OC)C(=O)N[C@H](C)[C@H](C2=CC=CC=C2)O
Synonyms:
  • (R)-tert-butyl 2-((1S,2R)-3-(((1S,2R)-1-hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate
Found 6 products.