CAS 160816-43-3

4-(morpholin-4-ylcarbonyl)benzoic acid

Description:

4-(Morpholin-4-ylcarbonyl)benzoic acid, identified by its CAS number 160816-43-3, is a chemical compound characterized by the presence of a benzoic acid moiety substituted with a morpholinyl carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic structures, contributing to its potential solubility in various organic solvents. The morpholine ring enhances its biological activity, making it of interest in medicinal chemistry, particularly for its potential applications in drug design and development. The carboxylic acid functional group imparts acidic characteristics, allowing for hydrogen bonding and interactions with biological targets. Additionally, the compound may exhibit moderate to high stability under standard conditions, although specific reactivity can depend on environmental factors such as pH and temperature. Its structural features suggest potential for various applications, including as an intermediate in organic synthesis or as a pharmacophore in therapeutic agents. Overall, 4-(morpholin-4-ylcarbonyl)benzoic acid represents a versatile compound with significant implications in chemical and pharmaceutical research.

Formula: C₁₂H₁₃NO₄

InChI: InChI=1/C12H13NO4/c14-11(13-5-7-17-8-6-13)9-1-3-10(4-2-9)12(15)16/h1-4H,5-8H2,(H,15,16)

SMILES: c1cc(ccc1C(=O)N1CCOCC1)C(=O)O

Synonyms:

• Benzoic Acid, 4-(4-Morpholinylcarbonyl)-

4-[(morpholin-4-yl)carbonyl]benzoic acid

CAS: 160816-43-3

Formula: C₁₂H₁₃NO₄

Molecular weight: 235.2359

Ref: IN-DA007BJ8

4-(Morpholin-4-ylcarbonyl)benzoic acid

CAS: 160816-43-3

4-(Morpholin-4-ylcarbonyl)benzoic acid is a useful scaffold and building block for the synthesis of complex organic compounds. It can be used as a reagent in organic synthesis, as well as in the preparation of pharmaceuticals. 4-(Morpholin-4-ylcarbonyl) benzoic acid is an intermediate for the production of many other chemical compounds and has been shown to be an effective research chemical.

Formula: C₁₂H₁₃NO₄

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 235.24 g/mol

Ref: 3D-FM133413