CAS 16083-76-4
:4,4,5,5,6,7,7,7-Octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl 2-propenoate
Description:
4,4,5,5,6,7,7,7-Octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl 2-propenoate, with CAS number 16083-76-4, is a fluorinated organic compound characterized by its unique structure that includes multiple fluorine atoms and a hydroxy group. This compound features a heptyl chain, which contributes to its hydrophobic properties, while the presence of the trifluoromethyl group enhances its chemical stability and lipophilicity. The octafluorination imparts significant thermal and chemical resistance, making it suitable for various applications, particularly in the fields of materials science and surface coatings. Its propenoate functional group suggests potential reactivity in polymerization processes, allowing it to be utilized in the synthesis of fluorinated polymers. Additionally, the compound's fluorinated nature may confer unique properties such as low surface energy and high resistance to solvents, which are advantageous in specialized applications. However, due to the environmental concerns associated with fluorinated compounds, its use may be subject to regulatory scrutiny. Overall, this compound exemplifies the intersection of fluorine chemistry and functional organic synthesis.
Formula:C11H9F11O3
InChI:InChI=1/C11H9F11O3/c1-2-6(24)25-4-5(23)3-7(12,13)9(15,16)8(14,10(17,18)19)11(20,21)22/h2,5,23H,1,3-4H2
InChI key:InChIKey=UMWCHHTXFDYJDZ-UHFFFAOYSA-N
SMILES:C(C(C(CC(COC(C=C)=O)O)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F
Synonyms:- 1,2-Heptanediol, 4,4,5,5,6,7,7,7-octafluoro-6-(trifluoromethyl)-, 1-acrylate
- 2-Propenoic acid, 4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl ester
- 3-(Perfluoro-3-methylbutyl)-2-hydroxypropyl acrylate
- 4,4,5,5,6,7,7,7-Octafluoro-2-Hydroxy-6-(Trifluoromethyl)Heptyl Prop-2-Enoate
- 4,4,5,5,6,7,7,7-Octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl 2-propenoate
- 4,4,5,5,6,7,7,7-Octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl acrylate
- Acrylic acid, 4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl ester
- DAIKIN R-3433
- 3-(perfluoro-3-methylbytyl)-2-hydroxypropylacrylate
- 3-(Perfluoro-3-methylbutyl)-2-hydroxypropylacrylate97%
- 3-(Perfluoro-3-methylbutyl)-2-hydroxypropyl acrylate 97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl ester
CAS:Formula:C11H9F11O3Molecular weight:398.1698
