CAS 160892-07-9

5-Bromo-1,3-benzenedicarbonitrile

Description:

5-Bromo-1,3-benzenedicarbonitrile is an organic compound characterized by its bromine and cyano functional groups attached to a benzene ring. The presence of two cyano groups (-C≡N) at the 1 and 3 positions of the benzene ring contributes to its reactivity and potential applications in organic synthesis and materials science. The bromine atom at the 5 position enhances the compound's electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in the synthesis of more complex organic molecules. Safety data should be consulted, as compounds containing bromine and cyano groups can pose health hazards and require careful handling. Overall, 5-Bromo-1,3-benzenedicarbonitrile is a versatile compound with significant utility in synthetic organic chemistry.

Formula: C₈H₃BrN₂

InChI: InChI=1/C8H3BrN2/c9-8-2-6(4-10)1-7(3-8)5-11/h1-3H

SMILES: c1c(cc(cc1C#N)Br)C#N

Synonyms:

• 5-Bromoisophthalonitrile
• 5-Bromobenzene-1,3-Dicarbonitrile

1,3-Benzenedicarbonitrile, 5-bromo-

CAS: 160892-07-9

Formula: C₈H₃BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.0268

Ref: IN-DA001VG7

5-Bromoisophthalonitrile

CAS: 160892-07-9

5-Bromoisophthalonitrile

Purity: 98%

Molecular weight: 207.03g/mol

Ref: 54-OR90303

5-Bromoisophthalonitrile

CAS: 160892-07-9

Formula: C₈H₃BrN₂

Purity: 95%

Color and Shape: Solid, Pale-yellow to yellow-brown solid

Molecular weight: 207.03

Ref: 10-F323573