CAS 1609-66-1
:4-(N-Propionylaniline)piperidine
Description:
4-(N-Propionylaniline)piperidine, with the CAS number 1609-66-1, is an organic compound that features a piperidine ring substituted with a 4-(N-propionylaniline) group. This compound typically exhibits characteristics common to amines and aromatic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of both an amine and an aromatic system. The piperidine moiety contributes to its basicity, while the propionylaniline substituent can influence its electronic properties and steric hindrance. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a building block in organic synthesis. Additionally, its structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as boiling point and melting point. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C14H20N2O
InChI:InChI=1S/C14H20N2O/c1-2-14(17)16(12-6-4-3-5-7-12)13-8-10-15-11-9-13/h3-7,13,15H,2,8-11H2,1H3
InChI key:InChIKey=PMCBDBWCQQBSRJ-UHFFFAOYSA-N
SMILES:N(C(CC)=O)(C1=CC=CC=C1)C2CCNCC2
Synonyms:- N-Phenyl-N-4-piperidinylpropanamide
- Propionanilide, N-4-piperidyl-
- Propanamide, N-phenyl-N-4-piperidinyl-
- 4-(N-Propionanilido)piperidine
- 4-(N-Propionylaniline)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Norfentanyl (N-Phenyl-N-(piperidin-4-yl)propanamide) 1.0 mg/ml in Methanol
CAS:Controlled ProductColor and Shape:Single SolutionFentanyl EP Impurity B
CAS:Controlled ProductFormula:C14H20N2OColor and Shape:NeatMolecular weight:232.32

