CAS 1609-92-3
:(Z)-3-Bromoacrylic acid
Description:
(Z)-3-Bromoacrylic acid is an organic compound characterized by its unsaturated carboxylic acid structure, featuring a bromine atom at the third carbon of the acrylic acid backbone. It has a double bond between the first and second carbon atoms, which contributes to its reactivity and potential for various chemical transformations. The "Z" configuration indicates that the bromine and the carboxylic acid group are on the same side of the double bond, influencing its stereochemistry and reactivity. This compound is typically a colorless to pale yellow liquid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It is used in organic synthesis and can serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. As with many brominated compounds, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and safety precautions are essential due to its potential reactivity and toxicity.
Formula:C3H3BrO2
InChI:InChI=1/C3H3BrO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/b2-1-
SMILES:C(=C\Br)\C(=O)O
Synonyms:- (2Z)-3-bromoprop-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Z)-3-Bromoacrylic acid
CAS:<p>(Z)-3-Bromoacrylic acid is an organic compound that belongs to the class of terminal alkynes. It has been shown to be a potent irreversible inhibitor of enantiopure propargylation catalyzed by dehalogenases. (Z)-3-Bromoacrylic acid reacts with the active site residues of the enzyme and forms a covalent bond, which prevents the release of acetaldehyde from propargyl alcohol. This reaction is reversible, which may cause some problems in cases where it is necessary to regenerate the enzyme. (Z)-3-Bromoacrylic acid also reacts with phosphite and halides to form five-membered rings, which are not as stable as six-membered rings.</p>Formula:C3H3BrO2Purity:Min. 95%Color and Shape:SolidMolecular weight:150.96 g/mol
