CymitQuimica logo

CAS 160911-12-6

:

2-Amino-4,6-dibromo-3-hydroxybenzoic acid

Description:
2-Amino-4,6-dibromo-3-hydroxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with various functional groups. The presence of two bromine atoms at the 4 and 6 positions, an amino group at the 2 position, and a hydroxyl group at the 3 position contributes to its unique chemical properties. This compound is classified as a derivative of salicylic acid, which is known for its applications in pharmaceuticals and agrochemicals. The amino group imparts basic characteristics, while the hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents. The dibromo substitution increases the compound's reactivity and potential for further chemical modifications. Additionally, the presence of these halogen atoms may influence its biological activity, making it a subject of interest in medicinal chemistry. Overall, 2-Amino-4,6-dibromo-3-hydroxybenzoic acid exhibits a combination of functional groups that can lead to diverse applications in various fields, including drug development and material science.
Formula:C7H5Br2NO3
InChI:InChI=1S/C7H5Br2NO3/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1,11H,10H2,(H,12,13)
InChI key:InChIKey=SEAVVBUQSYHVKP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(O)=C(Br)C=C1Br
Synonyms:
  • 4,6-Dibromo-3-hydroxyanthranilic acid
  • Benzoic acid, 2-amino-4,6-dibromo-3-hydroxy-
  • 2-Amino-4,6-dibromo-3-hydroxybenzoic acid
  • NCR 631
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.