CAS 16093-82-6
:1H-Imidazol-2-carboxamide
Description:
1H-Imidazol-2-carboxamide, also known as imidazole-2-carboxamide, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its polar nature and potential solubility in water. It typically appears as a white to off-white solid and is known for its role in various biochemical processes, particularly in the context of pharmaceuticals and biochemistry. The presence of the imidazole ring allows for interactions with biological molecules, making it relevant in medicinal chemistry. Its chemical properties include the ability to participate in hydrogen bonding due to the amide group, which can influence its reactivity and interactions in biological systems. Additionally, 1H-Imidazol-2-carboxamide may exhibit tautomerism, which can affect its stability and reactivity. Overall, this compound is of interest for its potential applications in drug development and as a biochemical probe.
Formula:C4H5N3O
InChI:InChI=1/C4H5N3O/c5-3(8)4-6-1-2-7-4/h1-2H,(H2,5,8)(H,6,7)
SMILES:c1cnc(C(=O)N)[nH]1
Synonyms:- 1H-Imidazole-2-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazol-2-carboxamide
CAS:Formula:C4H5N3OPurity:97%Color and Shape:SolidMolecular weight:111.10201H-Imidazole-2-carboxamide
CAS:Formula:C4H5N3OPurity:97%Color and Shape:SolidMolecular weight:111.1041H-Imidazole-2-carboxamide
CAS:1H-Imidazole-2-carboxamide is a purine derivative that can inhibit the activity of certain molecules. It has been shown to have an inhibitory effect on the metabolism of fatty acids and metabolism disorders, as well as the physiological effects of insulin resistance. The molecule also inhibits uptake and cross-linking in cells, which may be useful in treating cancer or other metabolic disorders.
Formula:C4H5N3OPurity:Min. 95%Color and Shape:PowderMolecular weight:111.1 g/molRef: 3D-FI143641
Discontinued product



