CAS 1609388-32-0

Bicyclo[3.1.1]hept-2-ene-2-ethanamine, 6,6-dimethyl-, hydrochloride (1:1), (1R,5S)-

Description:

Bicyclo[3.1.1]hept-2-ene-2-ethanamine, 6,6-dimethyl-, hydrochloride (1:1), (1R,5S)- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring system. The presence of the ethylamine functional group indicates that it has amine properties, which can influence its reactivity and interactions with other substances. The hydrochloride form suggests that it is a salt, enhancing its solubility in water and making it more stable for storage and handling. The specific stereochemistry (1R,5S) denotes the spatial arrangement of atoms in the molecule, which can significantly affect its biological activity and pharmacological properties. This compound may exhibit interesting properties due to its structural features, potentially making it relevant in medicinal chemistry or as a building block in organic synthesis. However, detailed studies would be necessary to fully understand its reactivity, potential applications, and safety profile.

Formula: C₁₁H₁₉N·ClH

InChI: InChI=1S/C11H19N.ClH/c1-11(2)9-4-3-8(5-6-12)10(11)7-9;/h3,9-10H,4-7,12H2,1-2H3;1H/t9-,10-;/m0./s1

InChI key: InChIKey=CZPGBBWGDHBXLR-IYPAPVHQSA-N

SMILES: C(CN)C=1[C@]2(C(C)(C)[C@](C2)(CC1)[H])[H].Cl

Synonyms:

• Bicyclo[3.1.1]hept-2-ene-2-ethanamine, 6,6-dimethyl-, hydrochloride (1:1), (1R,5S)-

2-[(1R,5S)-6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl]ethan-1-amine hydrochloride

CAS: 1609388-32-0

Versatile small molecule scaffold

Formula: C₁₁H₂₀ClN

Purity: Min. 95%

Molecular weight: 201.73 g/mol

Ref: 3D-JPC38832