CAS 1609388-36-4

Pyridine, 2-[5-(2S)-2-pyrrolidinyl-1,2,4-oxadiazol-3-yl]-, 2,2,2-trifluoroacetate (1:1)

Description:

Pyridine, 2-[5-(2S)-2-pyrrolidinyl-1,2,4-oxadiazol-3-yl]-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its complex structure, which includes a pyridine ring and a pyrrolidine moiety linked to an oxadiazole. The presence of the trifluoroacetate group enhances its solubility and reactivity, making it of interest in various chemical applications. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms and the presence of nitrogen in the heterocycles, which can influence its interaction with other molecules. Additionally, the oxadiazole ring may contribute to its potential biological activity, as oxadiazoles are often explored for their pharmacological properties. The compound's stereochemistry, indicated by the (2S) designation, suggests specific spatial arrangements that could affect its reactivity and interactions. Overall, this substance may be relevant in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₁₁H₁₂N₄O·C₂HF₃O₂

InChI: InChI=1S/C11H12N4O.C2HF3O2/c1-2-6-12-8(4-1)10-14-11(16-15-10)9-5-3-7-13-9;3-2(4,5)1(6)7/h1-2,4,6,9,13H,3,5,7H2;(H,6,7)/t9-;/m0./s1

InChI key: InChIKey=QVQBNLJZOKAZTI-FVGYRXGTSA-N

SMILES: C1(=NC(=NO1)C2=CC=CC=N2)[C@@H]3CCCN3.C(C(O)=O)(F)(F)F

Synonyms:

• Pyridine, 2-[5-(2S)-2-pyrrolidinyl-1,2,4-oxadiazol-3-yl]-, 2,2,2-trifluoroacetate (1:1)

2-{5-[(2S)-2-Pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine trifluoroacetate

CAS: 1609388-36-4

Formula: C₁₃H₁₃F₃N₄O₃

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 330.267

Ref: 10-F360727