CAS 1609388-60-4

L-Proline, 1-(4-piperidinyl)-, hydrochloride (1:2)

Description:

L-Proline, 1-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its structural components, which include a proline amino acid moiety and a piperidine ring. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions. It is often utilized in pharmaceutical research and development due to its potential biological activities, including roles in peptide synthesis and as a building block in drug design. The presence of the piperidine group may contribute to its pharmacological properties, potentially influencing receptor interactions or enzyme inhibition. As a hydrochloride salt, it is generally more stable and easier to handle than its free base form. The compound's molecular structure allows for various stereochemical configurations, which can affect its biological activity. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, L-Proline, 1-(4-piperidinyl)-, hydrochloride (1:2) represents a significant compound in medicinal chemistry with diverse applications.

Formula: C₁₀H₁₈N₂O₂·2ClH

InChI: InChI=1S/C10H18N2O2.2ClH/c13-10(14)9-2-1-7-12(9)8-3-5-11-6-4-8;;/h8-9,11H,1-7H2,(H,13,14);2*1H/t9-;;/m0../s1

InChI key: InChIKey=NFSHVJGFQYVCGD-WWPIYYJJSA-N

SMILES: C(O)(=O)[C@H]1N(CCC1)C2CCNCC2.Cl

Synonyms:

• L-Proline, 1-(4-piperidinyl)-, hydrochloride (1:2)

1-(4-piperidinyl)-L-proline dihydrochloride

CAS: 1609388-60-4

Formula: C₁₀H₂₀Cl₂N₂O₂

Purity: 95.0%

Molecular weight: 271.18

Ref: 10-F360734