CAS 1609388-61-5

Pyrrolo[1,2-a]pyrazine-1,4-dione, 7-aminohexahydro-, hydrochloride (1:1), (7R,8aS)-

Description:

Pyrrolo[1,2-a]pyrazine-1,4-dione, 7-aminohexahydro-, hydrochloride (1:1), (7R,8aS)- is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyrazine moiety. This compound features a hexahydro group, contributing to its saturated nature, and an amino group that enhances its potential for biological activity. The hydrochloride salt form indicates that it is a protonated version of the base compound, which often improves solubility in aqueous solutions, making it suitable for pharmaceutical applications. The specific stereochemistry, denoted by (7R,8aS), suggests that the compound has defined spatial arrangements of its atoms, which can significantly influence its reactivity and interaction with biological targets. Such compounds are often investigated for their potential therapeutic effects, particularly in areas such as neuropharmacology or oncology. Overall, the characteristics of this compound suggest it may have interesting properties for further research and development in medicinal chemistry.

Formula: C₇H₁₁N₃O₂·ClH

InChI: InChI=1S/C7H11N3O2.ClH/c8-4-1-5-7(12)9-2-6(11)10(5)3-4;/h4-5H,1-3,8H2,(H,9,12);1H/t4-,5+;/m1./s1

InChI key: InChIKey=PXWBGMFCTRXQJX-JBUOLDKXSA-N

SMILES: O=C1[C@]2(N(C[C@H](N)C2)C(=O)CN1)[H].Cl

Synonyms:

• Pyrrolo[1,2-a]pyrazine-1,4-dione, 7-aminohexahydro-, hydrochloride (1:1), (7R,8aS)-

(7R,8aS)-7-aminohexahydropyrrolo[1,2-a]pyrazine-1,4-dione hydrochloride

CAS: 1609388-61-5

Formula: C₇H₁₂ClN₃O₂

Purity: 95.0%

Molecular weight: 205.64

Ref: 10-F360371