CAS 1609394-05-9
:5-(2-Methoxy-3-nitrophenyl)-1H-1,2,4-triazole
Description:
5-(2-Methoxy-3-nitrophenyl)-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a methoxy group and a nitrophenyl substituent, contributing to its unique chemical properties and potential applications. The presence of the nitro group typically enhances the compound's reactivity and may influence its biological activity, making it of interest in pharmaceutical research. The methoxy group can affect solubility and polarity, which are critical factors in drug design. Additionally, the triazole moiety is known for its role in various biological activities, including antifungal and anticancer properties. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Overall, 5-(2-Methoxy-3-nitrophenyl)-1H-1,2,4-triazole is a compound of interest in medicinal chemistry, with potential applications in drug development and agrochemicals.
Formula:C9H8N4O3
InChI:InChI=1S/C9H8N4O3/c1-16-8-6(9-10-5-11-12-9)3-2-4-7(8)13(14)15/h2-5H,1H3,(H,10,11,12)
InChI key:InChIKey=CMGVPTUXPJERNL-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1N(=O)=O)C=2NC=NN2
Synonyms:- 5-(2-Methoxy-3-nitrophenyl)-1H-1,2,4-triazole
- 3-(2-Methoxy-3-nitrophenyl)-1H-1,2,4-triazole
- 1H-1,2,4-Triazole, 5-(2-methoxy-3-nitrophenyl)-
- EOS-61513
- BMS-986165 Related Compound 1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

