CAS 1609395-28-9

1,2,4-Oxadiazole-3-methanamine, 5-(2-methylpropyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-3-methanamine, 5-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methanamine group, contributing to its amine properties, and a branched alkyl substituent (2-methylpropyl) that influences its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the oxadiazole moiety suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. The compound's specific interactions, reactivity, and biological effects would depend on its structural features and the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₇H₁₃N₃O·ClH

InChI: InChI=1S/C7H13N3O.ClH/c1-5(2)3-7-9-6(4-8)10-11-7;/h5H,3-4,8H2,1-2H3;1H

InChI key: InChIKey=BABXFTYATJTINZ-UHFFFAOYSA-N

SMILES: C(C(C)C)C1=NC(CN)=NO1.Cl

Synonyms:

• 1,2,4-Oxadiazole-3-methanamine, 5-(2-methylpropyl)-, hydrochloride (1:1)

[(5-isobutyl-1,2,4-oxadiazol-3-yl)methyl]amine hydrochloride

CAS: 1609395-28-9

Formula: C₇H₁₄ClN₃O

Purity: 95.0%

Molecular weight: 191.66

Ref: 10-F359483