CAS 1609395-34-7

1H-1,2,4-Triazol-5-amine, 3-bromo-N,N,1-trimethyl-, hydrochloride (1:2)

Description:

1H-1,2,4-Triazol-5-amine, 3-bromo-N,N,1-trimethyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a bromine atom at the 3-position of the triazole ring and a trimethylamino group, contributing to its basicity and potential reactivity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. Its molecular structure suggests potential interactions with biological targets, and the presence of the bromine atom may influence its pharmacokinetic properties. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Safety and handling precautions should be observed due to its potential biological activity and the presence of bromine.

Formula: C₅H₉BrN₄·2ClH

InChI: InChI=1S/C5H9BrN4.2ClH/c1-9(2)5-7-4(6)8-10(5)3;;/h1-3H3;2*1H

InChI key: InChIKey=GQMDXDAKZOFYGS-UHFFFAOYSA-N

SMILES: N(C)(C)C1=NC(Br)=NN1C.Cl

Synonyms:

• 1H-1,2,4-Triazol-5-amine, 3-bromo-N,N,1-trimethyl-, hydrochloride (1:2)

3-bromo-N,N,1-trimethyl-1H-1,2,4-triazol-5-amine dihydrochloride

CAS: 1609395-34-7

Formula: C₅H₁₁BrCl₂N₄

Purity: 95.0%

Molecular weight: 277.98

Ref: 10-F360493