CAS 1609395-45-0

2-Pyridineacetic acid, 3-methyl-, hydrochloride (1:1)

Description:

2-Pyridineacetic acid, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a methyl group at the 3-position of the pyridine ring, which influences its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free acid form, making it useful in various applications, including pharmaceuticals and biochemical research. The presence of the hydrochloride indicates that the compound is in a protonated form, which can enhance its stability and bioavailability. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₉NO₂·ClH

InChI: InChI=1S/C8H9NO2.ClH/c1-6-3-2-4-9-7(6)5-8(10)11;/h2-4H,5H2,1H3,(H,10,11);1H

InChI key: InChIKey=JIEJZPKLYBSNHB-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(C)C=CC=N1.Cl

Synonyms:

• 2-(3-Methylpyridin-2-yl)acetic acid hydrochloride
• 2-Pyridineacetic acid, 3-methyl-, hydrochloride (1:1)

2-(3-Methylpyridin-2-yl)acetic acid hydrochloride

CAS: 1609395-45-0

Versatile small molecule scaffold

Formula: C₈H₁₀ClNO₂

Purity: Min. 95%

Molecular weight: 187.62 g/mol

Ref: 3D-JPC39545