CAS 1609395-56-3

3-Piperidinol, 3-[(dimethylamino)methyl]-, hydrochloride (1:2)

Description:

3-Piperidinol, 3-[(dimethylamino)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a hydroxyl group (-OH) at the 3-position of the piperidine ring contributes to its classification as a piperidinol. The compound also features a dimethylamino group, which is a nitrogen atom bonded to two methyl groups, attached to a methylene bridge (-CH2-) that connects to the piperidine ring. This structure imparts specific pharmacological properties, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. The compound may exhibit basic properties due to the presence of the nitrogen atoms, which can participate in hydrogen bonding and influence its interaction with biological systems. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₁₈N₂O·2ClH

InChI: InChI=1S/C8H18N2O.2ClH/c1-10(2)7-8(11)4-3-5-9-6-8;;/h9,11H,3-7H2,1-2H3;2*1H

InChI key: InChIKey=HZEBRFYXRGWOGK-UHFFFAOYSA-N

SMILES: C(N(C)C)C1(O)CCCNC1.Cl

Synonyms:

• 3-Piperidinol, 3-[(dimethylamino)methyl]-, hydrochloride (1:2)

3-[(Dimethylamino)methyl]piperidin-3-ol dihydrochloride

CAS: 1609395-56-3

Versatile small molecule scaffold

Formula: C₈H₂₀Cl₂N₂O

Purity: Min. 95%

Molecular weight: 231.16 g/mol

Ref: 3D-JPC39556