CAS 1609395-61-0: 1-Oxa-3,7-diazaspiro[4.5]decan-2-one, hydrochloride (1:1)

Description:1-Oxa-3,7-diazaspiro[4.5]decan-2-one, hydrochloride (1:1), identified by CAS number 1609395-61-0, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a bicyclic framework that includes a five-membered ring fused to a seven-membered ring, contributing to its rigidity and potential biological activity. The presence of the oxo group (C=O) and the hydrochloride salt form indicates that it may exhibit solubility in polar solvents, enhancing its utility in various applications, including medicinal chemistry. The diaza component suggests potential interactions with biological targets, making it of interest in pharmacological research. Its hydrochloride form typically enhances stability and solubility, which is advantageous for formulation in drug development. Overall, this compound's structural characteristics may confer specific reactivity and biological properties, warranting further investigation into its potential therapeutic applications.

Formula:C₇H₁₂N₂O₂·ClH

InChI:InChI=1S/C7H12N2O2.ClH/c10-6-9-5-7(11-6)2-1-3-8-4-7;/h8H,1-5H2,(H,9,10);1H

InChI key:InChIKey=JQVQEVZRMZRUEA-UHFFFAOYSA-N

SMILES:Cl.O=C1OC2(CN1)CNCCC2