CAS 1609395-63-2

1H-Pyrazole-1-ethanol, 4-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-ethanol, 4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a hydroxyl (-OH) group attached to the pyrazole ring, contributing to its classification as an alcohol. The presence of a methyl group at the 4-position of the pyrazole enhances its hydrophobic characteristics while also influencing its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals and research. The compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₆H₁₀N₂O·ClH

InChI: InChI=1S/C6H10N2O.ClH/c1-6-4-7-8(5-6)2-3-9;/h4-5,9H,2-3H2,1H3;1H

InChI key: InChIKey=HPMKHDQXTDXHKG-UHFFFAOYSA-N

SMILES: C(CO)N1C=C(C)C=N1.Cl

Synonyms:

• 1H-Pyrazole-1-ethanol, 4-methyl-, hydrochloride (1:1)

2-(4-methyl-1H-pyrazol-1-yl)ethanol hydrochloride

CAS: 1609395-63-2

Formula: C₆H₁₁ClN₂O

Purity: 95.0%

Molecular weight: 162.62

Ref: 10-F359824