CAS 1609395-70-1

Acetamide, N-(2-amino-4-chlorophenyl)-2-methoxy-, hydrochloride (1:1)

Description:

Acetamide, N-(2-amino-4-chlorophenyl)-2-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a chlorophenyl moiety, indicating the presence of a chlorine atom on the aromatic ring, specifically at the 4-position, and an amino group at the 2-position, contributing to its potential biological activity. The methoxy group at the 2-position enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit specific pharmacological properties due to its structural features, which could be relevant in medicinal chemistry. Its CAS number, 1609395-70-1, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in research and industry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage.

Formula: C₉H₁₁ClN₂O₂·ClH

InChI: InChI=1S/C9H11ClN2O2.ClH/c1-14-5-9(13)12-8-3-2-6(10)4-7(8)11;/h2-4H,5,11H2,1H3,(H,12,13);1H

InChI key: InChIKey=SHRLVGUCOFBGOT-UHFFFAOYSA-N

SMILES: N(C(COC)=O)C1=C(N)C=C(Cl)C=C1.Cl

Synonyms:

• Acetamide, N-(2-amino-4-chlorophenyl)-2-methoxy-, hydrochloride (1:1)

N-(2-amino-4-chlorophenyl)-2-methoxyacetamide hydrochloride

CAS: 1609395-70-1

Formula: C₉H₁₂Cl₂N₂O₂

Purity: 95.0%

Molecular weight: 251.11

Ref: 10-F359855