CAS 1609395-88-1

1H-Pyrazole-1-propanoic acid, 3,5-dimethyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-propanoic acid, 3,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a propanoic acid moiety, contributing to its acidic properties. The presence of two methyl groups at the 3 and 5 positions of the pyrazole ring enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1609395-88-1, allows for precise identification in chemical databases. Overall, this substance is notable for its structural features and potential applications in drug development and research.

Formula: C₈H₁₂N₂O₂·ClH

InChI: InChI=1S/C8H12N2O2.ClH/c1-6-5-7(2)10(9-6)4-3-8(11)12;/h5H,3-4H2,1-2H3,(H,11,12);1H

InChI key: InChIKey=AUHLOVSNZNZVSC-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1N=C(C)C=C1C.Cl

Synonyms:

• 1H-Pyrazole-1-propanoic acid, 3,5-dimethyl-, hydrochloride (1:1)

3-(3,5-dimethyl-1H-pyrazol-1-yl)propanoic acid hydrochloride

CAS: 1609395-88-1

Formula: C₈H₁₃ClN₂O₂

Purity: 95.0%

Molecular weight: 204.65

Ref: 10-F361043