CAS 1609395-89-2

Pyrazolo[1,5-a]pyrazine, 4,5,6,7-tetrahydro-2-methyl-, hydrochloride (1:2)

Description:

Pyrazolo[1,5-a]pyrazine, 4,5,6,7-tetrahydro-2-methyl-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a pyrazole ring fused to a pyrazine ring. This compound typically exists as a hydrochloride salt, indicating the presence of hydrochloric acid in its formulation, which enhances its solubility in water. The tetrahydro configuration suggests that the compound has undergone partial hydrogenation, resulting in a saturated structure that may influence its reactivity and biological activity. The methyl group at the 2-position contributes to its unique properties, potentially affecting its interaction with biological targets. Pyrazolo derivatives are often studied for their pharmacological activities, including anti-inflammatory and anti-cancer properties. The specific characteristics of this compound, such as its melting point, solubility, and spectral data, would be essential for applications in medicinal chemistry and drug development. As with many chemical substances, safety data and handling precautions are crucial for laboratory work involving this compound.

Formula: C₇H₁₁N₃·2ClH

InChI: InChI=1S/C7H11N3.2ClH/c1-6-4-7-5-8-2-3-10(7)9-6;;/h4,8H,2-3,5H2,1H3;2*1H

InChI key: InChIKey=MNYQSWYCNGOQGU-UHFFFAOYSA-N

SMILES: CC=1C=C2N(N1)CCNC2.Cl

Synonyms:

• Pyrazolo[1,5-a]pyrazine, 4,5,6,7-tetrahydro-2-methyl-, hydrochloride (1:2)

2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine dihydrochloride

CAS: 1609395-89-2

Formula: C₇H₁₃Cl₂N₃

Purity: 98%

Molecular weight: 210.1

Ref: 10-F360262