CAS 1609395-91-6

1,2,4-Oxadiazole-5-methanol, 3-(2-aminoethyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-methanol, 3-(2-aminoethyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring structure, which contributes to its potential biological activity. The presence of the methanol group and the aminoethyl side chain suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a ligand or a precursor in drug development. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability. The compound may exhibit various functional properties, including potential antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its molecular structure indicates the presence of nitrogen and oxygen heteroatoms, which can influence its reactivity and interaction with biological targets. Safety and handling considerations would be essential, as with any chemical substance, particularly in laboratory or pharmaceutical contexts. Overall, this compound represents a class of heterocyclic compounds that are of interest in the field of organic and medicinal chemistry.

Formula: C₅H₉N₃O₂·ClH

InChI: InChI=1S/C5H9N3O2.ClH/c6-2-1-4-7-5(3-9)10-8-4;/h9H,1-3,6H2;1H

InChI key: InChIKey=VWGCEQMSLXWRCM-UHFFFAOYSA-N

SMILES: C(CN)C=1N=C(CO)ON1.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-methanol, 3-(2-aminoethyl)-, hydrochloride (1:1)

[3-(2-aminoethyl)-1,2,4-oxadiazol-5-yl]methanol hydrochloride

CAS: 1609395-91-6

Formula: C₅H₁₀ClN₃O₂

Purity: 95.0%

Molecular weight: 179.6

Ref: 10-F360655