CAS 1609395-97-2

5-Pyrimidinecarboxylic acid, 2-(2-pyridinyl)-, hydrate (1:1)

Description:

5-Pyrimidinecarboxylic acid, 2-(2-pyridinyl)-, hydrate (1:1), with the CAS number 1609395-97-2, is a chemical compound characterized by its pyrimidine and pyridine functional groups. This substance typically exhibits properties associated with carboxylic acids, such as acidity and the ability to form hydrogen bonds due to the presence of the carboxyl group. The compound is likely to be a solid at room temperature and may have moderate solubility in polar solvents, owing to its hydrophilic nature from the carboxylic acid and the pyridine moiety. The hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its stability and reactivity. Additionally, the presence of nitrogen atoms in both the pyrimidine and pyridine rings may impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure.

Formula: C₁₀H₇N₃O₂·H₂O

InChI: InChI=1S/C10H7N3O2.H2O/c14-10(15)7-5-12-9(13-6-7)8-3-1-2-4-11-8;/h1-6H,(H,14,15);1H2

InChI key: InChIKey=ZFGNKVJHRWAYGP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=NC(=NC1)C2=CC=CC=N2.O

Synonyms:

• 5-Pyrimidinecarboxylic acid, 2-(2-pyridinyl)-, hydrate (1:1)

2-(2-pyridinyl)-5-pyrimidinecarboxylic acid hydrate

CAS: 1609395-97-2

Formula: C₁₀H₉N₃O₃

Purity: 95.0%

Molecular weight: 219.2

Ref: 10-F359663