CAS 1609396-04-4

3-Piperidinemethanol, 3-[(dimethylamino)methyl]-, hydrochloride (1:2)

Description:

3-Piperidinemethanol, 3-[(dimethylamino)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a hydroxymethyl group and a dimethylamino group, contributing to its potential as a pharmacological agent. The hydrochloride salt form indicates that it is a protonated version of the base, enhancing its solubility in water and stability. Typically, compounds of this nature may exhibit properties such as basicity due to the presence of the nitrogen atom, and they may participate in hydrogen bonding due to the hydroxyl group. The presence of both a piperidine and a dimethylamino group suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. As with many organic compounds, its reactivity and interactions can be influenced by the functional groups present, making it a subject of interest for further research in various chemical and biological contexts.

Formula: C₉H₂₀N₂O·2ClH

InChI: InChI=1S/C9H20N2O.2ClH/c1-11(2)7-9(8-12)4-3-5-10-6-9;;/h10,12H,3-8H2,1-2H3;2*1H

InChI key: InChIKey=CYVGUXUHENAFBZ-UHFFFAOYSA-N

SMILES: C(N(C)C)C1(CO)CCCNC1.Cl

Synonyms:

• 3-Piperidinemethanol, 3-[(dimethylamino)methyl]-, hydrochloride (1:2)

{3-[(dimethylamino)methyl]-3-piperidinyl}methanol dihydrochloride

CAS: 1609396-04-4

Formula: C₉H₂₂Cl₂N₂O

Purity: 95.0%

Molecular weight: 245.19

Ref: 10-F360365