CAS 1609396-08-8

Cyclopentanemethanamine, 1-(3-fluorophenyl)-, hydrochloride (1:1)

Description:

Cyclopentanemethanamine, 1-(3-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and an amine functional group. The presence of a 3-fluorophenyl substituent indicates that there is a fluorine atom attached to the aromatic ring, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit properties such as basicity due to the amine group, and its fluorinated aromatic component may contribute to specific interactions in biological systems. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for practical applications, including drug formulation and synthesis. Overall, the combination of these structural features suggests potential for diverse applications in medicinal chemistry and related fields.

Formula: C₁₂H₁₆FN·ClH

InChI: InChI=1S/C12H16FN.ClH/c13-11-5-3-4-10(8-11)12(9-14)6-1-2-7-12;/h3-5,8H,1-2,6-7,9,14H2;1H

InChI key: InChIKey=PLNZRPRSTLZLJV-UHFFFAOYSA-N

SMILES: C(N)C1(CCCC1)C2=CC(F)=CC=C2.Cl

Synonyms:

• Cyclopentanemethanamine, 1-(3-fluorophenyl)-, hydrochloride (1:1)

1-[1-(3-fluorophenyl)cyclopentyl]methanamine hydrochloride

CAS: 1609396-08-8

Formula: C₁₂H₁₇ClFN

Purity: 95.0%

Molecular weight: 229.72

Ref: 10-F359875