CAS 1609396-09-9

Benzoic acid, 4-(4-piperidinyloxy)-, hydrochloride (1:1)

Description:

Benzoic acid, 4-(4-piperidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its structural components, which include a benzoic acid moiety and a piperidine derivative. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt, which enhances its solubility compared to the free base form. The piperidinyloxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Its molecular structure allows for interactions with various biological targets, which could be relevant in drug development. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound represents a unique combination of organic functional groups that may have significant implications in medicinal chemistry.

Formula: C₁₂H₁₅NO₃·ClH

InChI: InChI=1S/C12H15NO3.ClH/c14-12(15)9-1-3-10(4-2-9)16-11-5-7-13-8-6-11;/h1-4,11,13H,5-8H2,(H,14,15);1H

InChI key: InChIKey=NHTKIPKHDVKBJY-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C(O)=O)C=C1)C2CCNCC2.Cl

Synonyms:

• Benzoic acid, 4-(4-piperidinyloxy)-, hydrochloride (1:1)

4-(4-Piperidinyloxy)benzoic acid hydrochloride

CAS: 1609396-09-9

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClNO₃

Purity: Min. 95%

Molecular weight: 257.71 g/mol

Ref: 3D-JPC39609