CAS 1609396-20-4

3,5-Piperidinedimethanol, hydrochloride (1:1), (3R,5S)-rel-

Description:

3,5-Piperidinedimethanol, hydrochloride (1:1), (3R,5S)-rel- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features two hydroxymethyl groups attached to the 3 and 5 positions of the piperidine ring, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The (3R,5S)-rel- designation refers to its specific stereochemistry, which can significantly influence its biological activity and interactions with biological targets. As a chiral molecule, it may exhibit different properties and effects depending on its stereoisomeric form. Overall, 3,5-Piperidinedimethanol, hydrochloride is of interest in research contexts, particularly in the development of new therapeutic agents or as a reagent in synthetic chemistry.

Formula: C₇H₁₅NO₂·ClH

InChI: InChI=1/C7H15NO2.ClH/c9-4-6-1-7(5-10)3-8-2-6;/h6-10H,1-5H2;1H/t6-,7+;

InChI key: InChIKey=OASRRWXKEIFOMR-UKMDXRBENA-N

SMILES: C(O)[C@H]1C[C@@H](CO)CNC1.Cl

Synonyms:

• 3,5-Piperidinedimethanol, hydrochloride (1:1), (3R,5S)-rel-

(3R,5S)-3,5-piperidinediyldimethanol hydrochloride

CAS: 1609396-20-4

Formula: C₇H₁₆ClNO₂

Purity: 95.0%

Molecular weight: 181.66

Ref: 10-F360543

[(3S,5R)-5-(Hydroxymethyl)piperidin-3-yl]methanol hydrochloride

CAS: 1609396-20-4

Versatile small molecule scaffold

Formula: C₇H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 181.66 g/mol

Ref: 3D-JPC39620