CAS 1609396-51-1

1-Piperidineethanamine, 4-amino-N,N-dimethyl-, hydrochloride (1:3)

Description:

1-Piperidineethanamine, 4-amino-N,N-dimethyl-, hydrochloride (1:3) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features an amino group and two dimethyl groups attached to the nitrogen, contributing to its basicity and potential for forming salts, such as the hydrochloride form. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular structure indicates it may interact with biological systems, potentially influencing neurotransmitter pathways or other physiological processes. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity. Overall, this compound represents a class of amines that may have significant implications in medicinal chemistry and drug development.

Formula: C₉H₂₁N₃·3ClH

InChI: InChI=1S/C9H21N3.3ClH/c1-11(2)7-8-12-5-3-9(10)4-6-12;;;/h9H,3-8,10H2,1-2H3;3*1H

InChI key: InChIKey=UATBTAMEMKGUFL-UHFFFAOYSA-N

SMILES: C(CN(C)C)N1CCC(N)CC1.Cl

Synonyms:

• 1-Piperidineethanamine, 4-amino-N,N-dimethyl-, hydrochloride (1:3)

1-[2-(dimethylamino)ethyl]-4-piperidinamine trihydrochloride

CAS: 1609396-51-1

Formula: C₉H₂₄Cl₃N₃

Purity: 95.0%

Molecular weight: 280.66

Ref: 10-F359945