CAS 1609396-55-5

Piperazine, 1-[(2-nitrophenyl)methyl]-, hydrochloride (1:1)

Description:

Piperazine, 1-[(2-nitrophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 2-nitrophenyl group indicates that the compound has a nitro substituent on the aromatic ring, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-parasitic activity, which is common for piperazine derivatives. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as nitro compounds can be hazardous. Overall, this compound represents a specific class of piperazine derivatives with potential applications in drug development and research.

Formula: C₁₁H₁₅N₃O₂·ClH

InChI: InChI=1S/C11H15N3O2.ClH/c15-14(16)11-4-2-1-3-10(11)9-13-7-5-12-6-8-13;/h1-4,12H,5-9H2;1H

InChI key: InChIKey=RQCUMEZZBVRDIF-UHFFFAOYSA-N

SMILES: C(C1=C(N(=O)=O)C=CC=C1)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-[(2-nitrophenyl)methyl]-, hydrochloride (1:1)

1-(2-nitrobenzyl)piperazine hydrochloride

CAS: 1609396-55-5

Formula: C₁₁H₁₆ClN₃O₂

Purity: 95.0%

Molecular weight: 257.72

Ref: 10-F361449