CAS 1609396-60-2

1H-Pyrazole-1-ethanamine, 4-methyl-, hydrochloride (1:2)

Description:

1H-Pyrazole-1-ethanamine, 4-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an ethylamine side chain and a methyl group at the 4-position of the pyrazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the hydrochloride group also indicates that it can exist as a stable crystalline solid, which is advantageous for storage and handling. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting specific pathways or conditions. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, making it a subject of study in both synthetic and applied chemistry contexts.

Formula: C₆H₁₁N₃·2ClH

InChI: InChI=1S/C6H11N3.2ClH/c1-6-4-8-9(5-6)3-2-7;;/h4-5H,2-3,7H2,1H3;2*1H

InChI key: InChIKey=FCUSSSWEEZLAQX-UHFFFAOYSA-N

SMILES: C(CN)N1C=C(C)C=N1.Cl

Synonyms:

• 1H-Pyrazole-1-ethanamine, 4-methyl-, hydrochloride (1:2)

[2-(4-methyl-1H-pyrazol-1-yl)ethyl]amine dihydrochloride

CAS: 1609396-60-2

Formula: C₆H₁₃Cl₂N₃

Purity: 95.0%

Molecular weight: 198.09

Ref: 10-F359720